| MolName | N-[(E)-3-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| MolecularFormula | C19H14N4O5S |
| Smiles | [O-][N+](c1ccc(/C=N\NC(/C(/NC(c2ccccc2)=O)=C\c2cccs2)=O)o1)=O |
| InChI | InChI=1S/C19H14N4O5S/c24-18(13-5-2-1-3-6-13)21-16(11-15-7-4-10-29-15)19(25)22-20-12-14-8-9-17(28-14)23(26)27/h1-12H,(H,21,24)(H,22,25) |
| InChIK | PYMCYSAQRFPLAG-UHFFFAOYSA-N |
| TotalMolweight | 410.409 |
| Molweight | 410.409 |
| MonoisotopicMass | 410.068491 |
| CLogP | 3.3034 |
| CLogS | -6.143 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 309.97 |
| Relative PSA | 0.40456 |
| PolarSurfaceArea | 157.76 |
| Druglikeness | 5.5393 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-3-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide | 2 - N-[(E)-3-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide