| MolName | 3-fluoro-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]benzamide |
| MolecularFormula | C14H11N2O2F |
| Smiles | O=C(c1cccc(F)c1)N/N=C\C=C\c1ccco1 |
| InChI | InChI=1S/C14H11FN2O2/c15-12-5-1-4-11(10-12)14(18)17-16-8-2-6-13-7-3-9-19-13/h1-10H,(H,17,18) |
| InChIK | PYSQALCDBYJCDN-UHFFFAOYSA-N |
| TotalMolweight | 258.251 |
| Molweight | 258.251 |
| MonoisotopicMass | 258.080456 |
| CLogP | 2.5094 |
| CLogS | -4.009 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 209.53 |
| Relative PSA | 0.2392 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 2.8234 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - 3-fluoro-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]benzamide | 2 - 3-fluoro-N-[(Z)-[(E)-3-(furan-2-yl)prop-2-enylidene]amino]benzamide