| MolName | 2-(4-fluorophenyl)-N-[(Z)-(2-phenylsulfanylphenyl)methylideneamino]acetamide |
| MolecularFormula | C21H17N2OFS |
| Smiles | O=C(Cc(cc1)ccc1F)N/N=C\c(cccc1)c1Sc1ccccc1 |
| InChI | InChI=1S/C21H17FN2OS/c22-18-12-10-16(11-13-18)14-21(25)24-23-15-17-6-4-5-9-20(17)26-19-7-2-1-3-8-19/h1-13,15H,14H2,(H,24,25) |
| InChIK | PYUOAVOTCXJFNR-UHFFFAOYSA-N |
| TotalMolweight | 364.443 |
| Molweight | 364.443 |
| MonoisotopicMass | 364.104561 |
| CLogP | 5.1216 |
| CLogS | -5.786 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 284.35 |
| Relative PSA | 0.18815 |
| PolarSurfaceArea | 66.76 |
| Druglikeness | 3.263 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-fluorophenyl)-N-[(Z)-(2-phenylsulfanylphenyl)methylideneamino]acetamide | 2 - 2-(4-fluorophenyl)-N-[(Z)-(2-phenylsulfanylphenyl)methylideneamino]acetamide