| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide |
| MolecularFormula | C18H16N10O4 |
| Smiles | NC(c(cccc1)c1NCc1c(C(N/N=C\c2ccco2)=O)nnn1-c1nonc1N)=O |
| InChI | InChI=1S/C18H16N10O4/c19-15-17(26-32-25-15)28-13(9-21-12-6-2-1-5-11(12)16(20)29)14(23-27-28)18(30)24-22-8-10-4-3-7-31-10/h1-8,21H,9H2,(H2,19,25)(H2,20,29)(H,24,30) |
| InChIK | PYXBANCUVKEREB-UHFFFAOYSA-N |
| TotalMolweight | 436.391 |
| Molweight | 436.391 |
| MonoisotopicMass | 436.1356 |
| CLogP | 1.0905 |
| CLogS | -2.606 |
| H Acceptors | 14 |
| H Donors | 4 |
| TotalSurfaceArea | 330.14 |
| Relative PSA | 0.51499 |
| PolarSurfaceArea | 205.37 |
| Druglikeness | 2.5472 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide