| MolName | 4-[(Z)-(3-hydroxyphenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C14H11N5OS |
| Smiles | Oc1cccc(/C=N\N(C(c2cnccc2)=NN2)C2=S)c1 |
| InChI | InChI=1S/C14H11N5OS/c20-12-5-1-3-10(7-12)8-16-19-13(17-18-14(19)21)11-4-2-6-15-9-11/h1-9,20H,(H,18,21) |
| InChIK | PYXUYZFPPMSOCL-UHFFFAOYSA-N |
| TotalMolweight | 297.341 |
| Molweight | 297.341 |
| MonoisotopicMass | 297.06843 |
| CLogP | 1.9484 |
| CLogS | -3.36 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 226.83 |
| Relative PSA | 0.39721 |
| PolarSurfaceArea | 105.2 |
| Druglikeness | 3.5019 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(3-hydroxyphenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(3-hydroxyphenyl)methylideneamino]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione