| MolName | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C20H15N3OS3 |
| Smiles | O=C(c1ccc(CSc2nc(cccc3)c3s2)cc1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C20H15N3OS3/c24-19(23-21-12-16-4-3-11-25-16)15-9-7-14(8-10-15)13-26-20-22-17-5-1-2-6-18(17)27-20/h1-12H,13H2,(H,23,24) |
| InChIK | PZWBRFVKXDJMOT-UHFFFAOYSA-N |
| TotalMolweight | 409.557 |
| Molweight | 409.557 |
| MonoisotopicMass | 409.037722 |
| CLogP | 5.5315 |
| CLogS | -6.996 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 303.24 |
| Relative PSA | 0.34689 |
| PolarSurfaceArea | 136.13 |
| Druglikeness | 6.0322 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide | 2 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide