| MolName | [(Z)-3-phenylpropylideneamino]urea |
| MolecularFormula | C10H13N3O |
| Smiles | NC(N/N=C\CCc1ccccc1)=O |
| InChI | InChI=1S/C10H13N3O/c11-10(14)13-12-8-4-7-9-5-2-1-3-6-9/h1-3,5-6,8H,4,7H2,(H3,11,13,14) |
| InChIK | PZXJVYVSIYGNKN-UHFFFAOYSA-N |
| TotalMolweight | 191.233 |
| Molweight | 191.233 |
| MonoisotopicMass | 191.105862 |
| CLogP | 1.2769 |
| CLogS | -2.971 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 163.27 |
| Relative PSA | 0.31408 |
| PolarSurfaceArea | 67.48 |
| Druglikeness | 3.1129 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.78571 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-3-phenylpropylideneamino]urea | 2 - [(Z)-3-phenylpropylideneamino]urea