| MolName | N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C14H8N3O3ClS2 |
| Smiles | [O-][N+](c(cc1)cc2c1sc(C(N/N=C\c(s1)ccc1Cl)=O)c2)=O |
| InChI | InChI=1S/C14H8ClN3O3S2/c15-13-4-2-10(22-13)7-16-17-14(19)12-6-8-5-9(18(20)21)1-3-11(8)23-12/h1-7H,(H,17,19) |
| InChIK | PZYPWEAOHSYUEQ-UHFFFAOYSA-N |
| TotalMolweight | 365.821 |
| Molweight | 365.821 |
| MonoisotopicMass | 364.969559 |
| CLogP | 3.8785 |
| CLogS | -6.293 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 252.56 |
| Relative PSA | 0.42426 |
| PolarSurfaceArea | 143.76 |
| Druglikeness | 0.76948 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-(5-chlorothiophen-2-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide