| MolName | N'-[(Z)-furan-2-ylmethylideneamino]-N-(4-phenoxyphenyl)oxamide |
| MolecularFormula | C19H15N3O4 |
| Smiles | O=C(C(N/N=C\c1ccco1)=O)Nc(cc1)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C19H15N3O4/c23-18(19(24)22-20-13-17-7-4-12-25-17)21-14-8-10-16(11-9-14)26-15-5-2-1-3-6-15/h1-13H,(H,21,23)(H,22,24) |
| InChIK | QAEVCGRDVRTSKC-UHFFFAOYSA-N |
| TotalMolweight | 349.345 |
| Molweight | 349.345 |
| MonoisotopicMass | 349.106257 |
| CLogP | 2.7282 |
| CLogS | -5.504 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 275.65 |
| Relative PSA | 0.30698 |
| PolarSurfaceArea | 92.93 |
| Druglikeness | 3.5055 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-furan-2-ylmethylideneamino]-N-(4-phenoxyphenyl)oxamide | 2 - N'-[(Z)-furan-2-ylmethylideneamino]-N-(4-phenoxyphenyl)oxamide