| MolName | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| MolecularFormula | C17H13N6O3BrS |
| Smiles | O=C(CSc1nnnn1-c1ccccc1)N/N=C\c(cc1OCOc1c1)c1Br |
| InChI | InChI=1S/C17H13BrN6O3S/c18-13-7-15-14(26-10-27-15)6-11(13)8-19-20-16(25)9-28-17-21-22-23-24(17)12-4-2-1-3-5-12/h1-8H,9-10H2,(H,20,25) |
| InChIK | QAIVYAJKESNPSF-UHFFFAOYSA-N |
| TotalMolweight | 461.299 |
| Molweight | 461.299 |
| MonoisotopicMass | 459.99532 |
| CLogP | 3.3917 |
| CLogS | -5.876 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 302.37 |
| Relative PSA | 0.37464 |
| PolarSurfaceArea | 128.82 |
| Druglikeness | 1.7931 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide | 2 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide