| MolName | (Z)-N-(2,4-dichlorophenyl)-4-(furan-2-yl)-3-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-imine |
| MolecularFormula | C19H12N4OCl2S |
| Smiles | Clc(cc1)cc(Cl)c1/N=C1\SC=C(c2ccco2)N1/N=C\c1cnccc1 |
| InChI | InChI=1S/C19H12Cl2N4OS/c20-14-5-6-16(15(21)9-14)24-19-25(23-11-13-3-1-7-22-10-13)17(12-27-19)18-4-2-8-26-18/h1-12H |
| InChIK | QAIWQSCYPJYTBH-UHFFFAOYSA-N |
| TotalMolweight | 415.303 |
| Molweight | 415.303 |
| MonoisotopicMass | 414.010885 |
| CLogP | 4.7639 |
| CLogS | -5.993 |
| H Acceptors | 5 |
| TotalSurfaceArea | 298.8 |
| Relative PSA | 0.23139 |
| PolarSurfaceArea | 79.29 |
| Druglikeness | 3.5889 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(2,4-dichlorophenyl)-4-(furan-2-yl)-3-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-imine | 2 - (Z)-N-(2,4-dichlorophenyl)-4-(furan-2-yl)-3-[(Z)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-imine