| MolName | N-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-chlorophenoxy)methyl]benzamide |
| MolecularFormula | C30H22N4O2BrCl |
| Smiles | O=C(c1ccc(COc(cc2)ccc2Cl)cc1)N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1Br |
| InChI | InChI=1S/C30H22BrClN4O2/c31-25-12-10-22(11-13-25)29-24(19-36(35-29)27-4-2-1-3-5-27)18-33-34-30(37)23-8-6-21(7-9-23)20-38-28-16-14-26(32)15-17-28/h1-19H,20H2,(H,34,37) |
| InChIK | QAJZCSQDLSLCRK-UHFFFAOYSA-N |
| TotalMolweight | 585.888 |
| Molweight | 585.888 |
| MonoisotopicMass | 584.061464 |
| CLogP | 6.7999 |
| CLogS | -8.145 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 412.04 |
| Relative PSA | 0.15496 |
| PolarSurfaceArea | 68.51 |
| Druglikeness | 3.7929 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-chlorophenoxy)methyl]benzamide | 2 - N-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-chlorophenoxy)methyl]benzamide