| MolName | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-3-phenylpropylideneamino]acetamide |
| MolecularFormula | C17H17N2OClS |
| Smiles | O=C(CSc(cc1)ccc1Cl)N/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C17H17ClN2OS/c18-15-8-10-16(11-9-15)22-13-17(21)20-19-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-12H,4,7,13H2,(H,20,21) |
| InChIK | QAYHDQZZJUUBDH-UHFFFAOYSA-N |
| TotalMolweight | 332.854 |
| Molweight | 332.854 |
| MonoisotopicMass | 332.07501 |
| CLogP | 4.162 |
| CLogS | -5.156 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 261.18 |
| Relative PSA | 0.20484 |
| PolarSurfaceArea | 66.76 |
| Druglikeness | 3.654 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.77273 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenyl)sulfanyl-N-[(Z)-3-phenylpropylideneamino]acetamide | 2 - 2-(4-chlorophenyl)sulfanyl-N-[(Z)-3-phenylpropylideneamino]acetamide