| MolName | 6-chloro-N-[(Z)-(5-chlorofuran-2-yl)methylideneamino]-4-phenylquinolin-2-amine |
| MolecularFormula | C20H13N3OCl2 |
| Smiles | Clc1ccc(/C=N\Nc2cc(-c3ccccc3)c(cc(cc3)Cl)c3n2)o1 |
| InChI | InChI=1S/C20H13Cl2N3O/c21-14-6-8-18-17(10-14)16(13-4-2-1-3-5-13)11-20(24-18)25-23-12-15-7-9-19(22)26-15/h1-12H,(H,24,25) |
| InChIK | QBCYUZJSGQDVMO-UHFFFAOYSA-N |
| TotalMolweight | 382.249 |
| Molweight | 382.249 |
| MonoisotopicMass | 381.043566 |
| CLogP | 7.6656 |
| CLogS | -7.383 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 282.89 |
| Relative PSA | 0.16985 |
| PolarSurfaceArea | 50.42 |
| Druglikeness | 2.0372 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-chloro-N-[(Z)-(5-chlorofuran-2-yl)methylideneamino]-4-phenylquinolin-2-amine | 2 - 6-chloro-N-[(Z)-(5-chlorofuran-2-yl)methylideneamino]-4-phenylquinolin-2-amine