| MolName | 4-[(Z)-(4-chlorophenyl)methylideneamino]-3-[4-[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]butyl]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C22H20N8Cl2S2 |
| Smiles | S=C(NN=C1CCCCC(N2/N=C\c(cc3)ccc3Cl)=NNC2=S)N1/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C22H20Cl2N8S2/c23-17-9-5-15(6-10-17)13-25-31-19(27-29-21(31)33)3-1-2-4-20-28-30-22(34)32(20)26-14-16-7-11-18(24)12-8-16/h5-14H,1-4H2,(H,29,33)(H,30,34) |
| InChIK | QBFGQYFWJMYSQR-UHFFFAOYSA-N |
| TotalMolweight | 531.495 |
| Molweight | 531.495 |
| MonoisotopicMass | 530.062936 |
| CLogP | 5.8054 |
| CLogS | -8.13 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 396.3 |
| Relative PSA | 0.33323 |
| PolarSurfaceArea | 144.16 |
| Druglikeness | -1.5856 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(4-chlorophenyl)methylideneamino]-3-[4-[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]butyl]-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(4-chlorophenyl)methylideneamino]-3-[4-[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]butyl]-1H-1,2,4-triazole-5-thione