| MolName | 4-fluoro-N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]benzamide |
| MolecularFormula | C26H20N3OF |
| Smiles | O=C(c(cc1)ccc1F)N/N=C\c(cc1)ccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20FN3O/c27-22-15-13-21(14-16-22)26(31)29-28-19-20-11-17-25(18-12-20)30(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-19H,(H,29,31) |
| InChIK | QBZAMCHLUZDZHI-UHFFFAOYSA-N |
| TotalMolweight | 409.463 |
| Molweight | 409.463 |
| MonoisotopicMass | 409.15904 |
| CLogP | 5.8968 |
| CLogS | -8.211 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 323.16 |
| Relative PSA | 0.12242 |
| PolarSurfaceArea | 44.7 |
| Druglikeness | 3.7362 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 12 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-fluoro-N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]benzamide | 2 - 4-fluoro-N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]benzamide