| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4H-pyrazole-3-carboxamide |
| MolecularFormula | C11H8N4OCl2 |
| Smiles | O=C(C1=NN=CC1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C11H8Cl2N4O/c12-8-2-1-7(9(13)5-8)6-15-17-11(18)10-3-4-14-16-10/h1-2,4-6H,3H2,(H,17,18) |
| InChIK | QCGLSUKRLBOFTD-UHFFFAOYSA-N |
| TotalMolweight | 283.118 |
| Molweight | 283.118 |
| MonoisotopicMass | 282.007515 |
| CLogP | 3.8026 |
| CLogS | -4.705 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 206.06 |
| Relative PSA | 0.28647 |
| PolarSurfaceArea | 66.18 |
| Druglikeness | 5.9051 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4H-pyrazole-3-carboxamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4H-pyrazole-3-carboxamide