| MolName | 3-[[4-chloro-5-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate |
| MolecularFormula | C19H12N4O6ClS |
| Smiles | [O-]C(c1cccc(CN(C(Cl)=C(/C=N\NC(c(cc2)ccc2[N+]([O-])=O)=O)S2)C2=O)c1)=O |
| InChI | InChI=1S/C19H13ClN4O6S/c20-16-15(9-21-22-17(25)12-4-6-14(7-5-12)24(29)30)31-19(28)23(16)10-11-2-1-3-13(8-11)18(26)27/h1-9H,10H2,(H,22,25)(H,26,27)/p-1 |
| InChIK | QCKRFOKDDOCWGH-UHFFFAOYSA-M |
| TotalMolweight | 459.845 |
| Molweight | 459.845 |
| MonoisotopicMass | 459.016608 |
| CLogP | 0.0594 |
| CLogS | -5.801 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 320.08 |
| Relative PSA | 0.39937 |
| PolarSurfaceArea | 173.02 |
| Druglikeness | 2.3934 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[4-chloro-5-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate | 2 - 3-[[4-chloro-5-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate