| MolName | N-[(Z)-2,2,3,3,3-pentafluoropropylideneamino]benzamide |
| MolecularFormula | C10H7N2OF5 |
| Smiles | O=C(c1ccccc1)N/N=C\C(C(F)(F)F)(F)F |
| InChI | InChI=1S/C10H7F5N2O/c11-9(12,10(13,14)15)6-16-17-8(18)7-4-2-1-3-5-7/h1-6H,(H,17,18) |
| InChIK | QCYPPGMCVZDNHO-UHFFFAOYSA-N |
| TotalMolweight | 266.169 |
| Molweight | 266.169 |
| MonoisotopicMass | 266.047853 |
| CLogP | 2.6402 |
| CLogS | -3.931 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 179.8 |
| Relative PSA | 0.20028 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | -35.677 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2,2,3,3,3-pentafluoropropylideneamino]benzamide | 2 - N-[(Z)-2,2,3,3,3-pentafluoropropylideneamino]benzamide