| MolName | 2,4-difluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]aniline |
| MolecularFormula | C15H11N3O2F2 |
| Smiles | [O-][N+](c1c(/C=C/C=N\Nc(ccc(F)c2)c2F)cccc1)=O |
| InChI | InChI=1S/C15H11F2N3O2/c16-12-7-8-14(13(17)10-12)19-18-9-3-5-11-4-1-2-6-15(11)20(21)22/h1-10,19H |
| InChIK | QDDAWRBDQWBXMO-UHFFFAOYSA-N |
| TotalMolweight | 303.267 |
| Molweight | 303.267 |
| MonoisotopicMass | 303.081933 |
| CLogP | 4.1392 |
| CLogS | -4.529 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 232.11 |
| Relative PSA | 0.23002 |
| PolarSurfaceArea | 70.21 |
| Druglikeness | -4.425 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-difluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]aniline | 2 - 2,4-difluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]aniline