| MolName | [4-[(Z)-[[2-(5-benzamido-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| MolecularFormula | C24H19N5O5S2 |
| Smiles | O=C(Cc1nnc(NC(c2ccccc2)=O)s1)N/N=C\c(cc1)ccc1OS(c1ccccc1)(=O)=O |
| InChI | InChI=1S/C24H19N5O5S2/c30-21(15-22-28-29-24(35-22)26-23(31)18-7-3-1-4-8-18)27-25-16-17-11-13-19(14-12-17)34-36(32,33)20-9-5-2-6-10-20/h1-14,16H,15H2,(H,27,30)(H,26,29,31) |
| InChIK | QDQUGRBRIOGKFX-UHFFFAOYSA-N |
| TotalMolweight | 521.577 |
| Molweight | 521.577 |
| MonoisotopicMass | 521.08276 |
| CLogP | 4.0691 |
| CLogS | -5.179 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 381.52 |
| Relative PSA | 0.3706 |
| PolarSurfaceArea | 176.33 |
| Druglikeness | 1.4488 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(5-benzamido-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate | 2 - [4-[(Z)-[[2-(5-benzamido-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate