| MolName | 4-[(Z)-benzylideneamino]-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
| MolecularFormula | C15H19N5S |
| Smiles | S=C(N(CN1CCCCC1)N=C1)N1/N=C\c1ccccc1 |
| InChI | InChI=1S/C15H19N5S/c21-15-19(16-11-14-7-3-1-4-8-14)12-17-20(15)13-18-9-5-2-6-10-18/h1,3-4,7-8,11-12H,2,5-6,9-10,13H2 |
| InChIK | QDSOTTGENMSKTC-UHFFFAOYSA-N |
| TotalMolweight | 301.417 |
| Molweight | 301.417 |
| MonoisotopicMass | 301.136115 |
| CLogP | 2.5184 |
| CLogS | -3.853 |
| H Acceptors | 5 |
| TotalSurfaceArea | 241.95 |
| Relative PSA | 0.25489 |
| PolarSurfaceArea | 66.53 |
| Druglikeness | 3.5316 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | methanediamine; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-benzylideneamino]-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione | 2 - 4-[(Z)-benzylideneamino]-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione