| MolName | 3-naphthalen-1-yl-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C21H15N5O3 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(c2cc(-c3cccc4ccccc34)n[nH]2)=O)cc1)=O |
| InChI | InChI=1S/C21H15N5O3/c27-21(25-22-13-14-8-10-16(11-9-14)26(28)29)20-12-19(23-24-20)18-7-3-5-15-4-1-2-6-17(15)18/h1-13H,(H,23,24)(H,25,27) |
| InChIK | QECLWGWEQYBMMK-UHFFFAOYSA-N |
| TotalMolweight | 385.382 |
| Molweight | 385.382 |
| MonoisotopicMass | 385.11749 |
| CLogP | 3.1722 |
| CLogS | -6.162 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 293.35 |
| Relative PSA | 0.31154 |
| PolarSurfaceArea | 115.96 |
| Druglikeness | 0.51666 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-naphthalen-1-yl-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide | 2 - 3-naphthalen-1-yl-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide