| MolName | N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-2-phenylacetamide |
| MolecularFormula | C16H16N4O2 |
| Smiles | O=C(Cc1ccccc1)NCC(N/N=C\c1cnccc1)=O |
| InChI | InChI=1S/C16H16N4O2/c21-15(9-13-5-2-1-3-6-13)18-12-16(22)20-19-11-14-7-4-8-17-10-14/h1-8,10-11H,9,12H2,(H,18,21)(H,20,22) |
| InChIK | QEOCEAKPNMOJHU-UHFFFAOYSA-N |
| TotalMolweight | 296.329 |
| Molweight | 296.329 |
| MonoisotopicMass | 296.127326 |
| CLogP | 1.2825 |
| CLogS | -2.658 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 242.48 |
| Relative PSA | 0.29479 |
| PolarSurfaceArea | 83.45 |
| Druglikeness | 5.3942 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-2-phenylacetamide | 2 - N-[2-oxo-2-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]ethyl]-2-phenylacetamide