| MolName | N-[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C15H12N4O7 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CNC(c(cc2)cc3c2OCO3)=O)=O)o1)=O |
| InChI | InChI=1S/C15H12N4O7/c20-13(18-17-6-10-2-4-14(26-10)19(22)23)7-16-15(21)9-1-3-11-12(5-9)25-8-24-11/h1-6H,7-8H2,(H,16,21)(H,18,20) |
| InChIK | QEOFVCGZNAKGBM-UHFFFAOYSA-N |
| TotalMolweight | 360.281 |
| Molweight | 360.281 |
| MonoisotopicMass | 360.070601 |
| CLogP | 1.0152 |
| CLogS | -4.866 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 263.58 |
| Relative PSA | 0.47439 |
| PolarSurfaceArea | 147.98 |
| Druglikeness | 3.8289 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide | 2 - N-[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide