| MolName | 4-[(Z)-thiophen-2-ylmethylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C8H5N4F3S2 |
| Smiles | FC(C(N1/N=C\c2cccs2)=NNC1=S)(F)F |
| InChI | InChI=1S/C8H5F3N4S2/c9-8(10,11)6-13-14-7(16)15(6)12-4-5-2-1-3-17-5/h1-4H,(H,14,16) |
| InChIK | QEPXMEYZBZEGAB-UHFFFAOYSA-N |
| TotalMolweight | 278.282 |
| Molweight | 278.282 |
| MonoisotopicMass | 277.99077 |
| CLogP | 2.2274 |
| CLogS | -4.031 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 187.36 |
| Relative PSA | 0.46109 |
| PolarSurfaceArea | 100.32 |
| Druglikeness | -6.3935 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-thiophen-2-ylmethylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-thiophen-2-ylmethylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione