| MolName | 3,5-dichloro-N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C18H17N5Cl2S2 |
| Smiles | Clc1cc(Cl)c(N/N=C\c2c(-c3cccs3)nc(N3CCCCC3)s2)nc1 |
| InChI | InChI=1S/C18H17Cl2N5S2/c19-12-9-13(20)17(21-10-12)24-22-11-15-16(14-5-4-8-26-14)23-18(27-15)25-6-2-1-3-7-25/h4-5,8-11H,1-3,6-7H2,(H,21,24) |
| InChIK | QEWIVNOVGSONRQ-UHFFFAOYSA-N |
| TotalMolweight | 438.406 |
| Molweight | 438.406 |
| MonoisotopicMass | 437.030239 |
| CLogP | 7.7176 |
| CLogS | -6.885 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 314.84 |
| Relative PSA | 0.28325 |
| PolarSurfaceArea | 109.89 |
| Druglikeness | 4.67 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3,5-dichloro-N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]pyridin-2-amine | 2 - 3,5-dichloro-N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]pyridin-2-amine