| MolName | 4-[(2Z)-2-[(2-fluorophenyl)methylidene]hydrazinyl]benzenesulfonate |
| MolecularFormula | C13H10N2O3FS |
| Smiles | [O-]S(c(cc1)ccc1N/N=C\c(cccc1)c1F)(=O)=O |
| InChI | InChI=1S/C13H11FN2O3S/c14-13-4-2-1-3-10(13)9-15-16-11-5-7-12(8-6-11)20(17,18)19/h1-9,16H,(H,17,18,19)/p-1 |
| InChIK | QFDQWYOIBFJOFS-UHFFFAOYSA-M |
| TotalMolweight | 293.297 |
| Molweight | 293.297 |
| MonoisotopicMass | 293.039616 |
| CLogP | 1.4648 |
| CLogS | -2.069 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 211.7 |
| Relative PSA | 0.31096 |
| PolarSurfaceArea | 89.97 |
| Druglikeness | -11.692 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(2-fluorophenyl)methylidene]hydrazinyl]benzenesulfonate | 2 - 4-[(2Z)-2-[(2-fluorophenyl)methylidene]hydrazinyl]benzenesulfonate