| MolName | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| MolecularFormula | C23H16N4O2Cl2S |
| Smiles | O=C(CSC(N1c2ccccc2)=Nc(cccc2)c2C1=O)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C23H16Cl2N4O2S/c24-18-11-10-15(12-19(18)25)13-26-28-21(30)14-32-23-27-20-9-5-4-8-17(20)22(31)29(23)16-6-2-1-3-7-16/h1-13H,14H2,(H,28,30) |
| InChIK | QFFHNXKFPCZSSZ-UHFFFAOYSA-N |
| TotalMolweight | 483.378 |
| Molweight | 483.378 |
| MonoisotopicMass | 482.0371 |
| CLogP | 5.4225 |
| CLogS | -7.597 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 346.36 |
| Relative PSA | 0.23559 |
| PolarSurfaceArea | 99.43 |
| Druglikeness | 5.7508 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide | 2 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide