| MolName | 4-[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl]-2-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]pyrido[2,3-b]pyrazin-3-one |
| MolecularFormula | C22H16N7OClF4 |
| Smiles | O=C1N(CCNc(ncc(C(F)(F)F)c2)c2Cl)c2ncccc2N=C1N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C22H16ClF4N7O/c23-16-10-14(22(25,26)27)12-30-18(16)28-8-9-34-20-17(2-1-7-29-20)32-19(21(34)35)33-31-11-13-3-5-15(24)6-4-13/h1-7,10-12H,8-9H2,(H,28,30)(H,32,33) |
| InChIK | QFLQTRZORQKCQV-UHFFFAOYSA-N |
| TotalMolweight | 505.862 |
| Molweight | 505.862 |
| MonoisotopicMass | 505.104097 |
| CLogP | 3.2406 |
| CLogS | -6.213 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 354.25 |
| Relative PSA | 0.23845 |
| PolarSurfaceArea | 94.87 |
| Druglikeness | -0.38799 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl]-2-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]pyrido[2,3-b]pyrazin-3-one | 2 - 4-[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl]-2-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]pyrido[2,3-b]pyrazin-3-one