| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C25H19N3O6 |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c(cc1)cc2c1OCO2)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C25H19N3O6/c29-24(18-4-2-1-3-5-18)27-19(10-16-6-8-20-22(11-16)33-14-31-20)25(30)28-26-13-17-7-9-21-23(12-17)34-15-32-21/h1-13H,14-15H2,(H,27,29)(H,28,30) |
| InChIK | QGCZBHATUMZYPQ-UHFFFAOYSA-N |
| TotalMolweight | 457.441 |
| Molweight | 457.441 |
| MonoisotopicMass | 457.127387 |
| CLogP | 5.0411 |
| CLogS | -6.888 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 341.19 |
| Relative PSA | 0.29459 |
| PolarSurfaceArea | 107.48 |
| Druglikeness | 6.2698 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide