| MolName | N-[1-[(Z)-(2-fluorophenyl)methylideneamino]tetrazol-5-yl]naphthalene-1-carboxamide |
| MolecularFormula | C19H13N6OF |
| Smiles | O=C(c1cccc2ccccc12)Nc1nnnn1/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C19H13FN6O/c20-17-11-4-2-7-14(17)12-21-26-19(23-24-25-26)22-18(27)16-10-5-8-13-6-1-3-9-15(13)16/h1-12H,(H,22,23,25,27) |
| InChIK | QHDNRBBFXITVHZ-UHFFFAOYSA-N |
| TotalMolweight | 360.351 |
| Molweight | 360.351 |
| MonoisotopicMass | 360.113487 |
| CLogP | 4.3465 |
| CLogS | -7.143 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 273.18 |
| Relative PSA | 0.27744 |
| PolarSurfaceArea | 85.06 |
| Druglikeness | 1.451 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Amides | 1 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[1-[(Z)-(2-fluorophenyl)methylideneamino]tetrazol-5-yl]naphthalene-1-carboxamide | 2 - N-[1-[(Z)-(2-fluorophenyl)methylideneamino]tetrazol-5-yl]naphthalene-1-carboxamide