| MolName | 3-(2,3-diphenylindol-1-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]propanamide |
| MolecularFormula | C28H23N3OS |
| Smiles | O=C(CCn(c1c2cccc1)c(-c1ccccc1)c2-c1ccccc1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C28H23N3OS/c32-26(30-29-20-23-14-9-19-33-23)17-18-31-25-16-8-7-15-24(25)27(21-10-3-1-4-11-21)28(31)22-12-5-2-6-13-22/h1-16,19-20H,17-18H2,(H,30,32) |
| InChIK | QHFVOFMNCRURCJ-UHFFFAOYSA-N |
| TotalMolweight | 449.577 |
| Molweight | 449.577 |
| MonoisotopicMass | 449.156182 |
| CLogP | 6.5988 |
| CLogS | -7.52 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 353.77 |
| Relative PSA | 0.17876 |
| PolarSurfaceArea | 74.63 |
| Druglikeness | 7.7757 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,3-diphenylindol-1-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]propanamide | 2 - 3-(2,3-diphenylindol-1-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]propanamide