| MolName | 4-[[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]benzoate |
| MolecularFormula | C20H14N2O4IS |
| Smiles | [O-]C(c1ccc(COc(ccc(/C=N\NC(c2cccs2)=O)c2)c2I)cc1)=O |
| InChI | InChI=1S/C20H15IN2O4S/c21-16-10-14(11-22-23-19(24)18-2-1-9-28-18)5-8-17(16)27-12-13-3-6-15(7-4-13)20(25)26/h1-11H,12H2,(H,23,24)(H,25,26)/p-1 |
| InChIK | QHKQUZWUMHFYDH-UHFFFAOYSA-M |
| TotalMolweight | 505.307 |
| Molweight | 505.307 |
| MonoisotopicMass | 504.971901 |
| CLogP | 2.2625 |
| CLogS | -6.101 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 318.01 |
| Relative PSA | 0.29461 |
| PolarSurfaceArea | 119.06 |
| Druglikeness | 6.3842 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]benzoate | 2 - 4-[[2-iodo-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]benzoate