| MolName | N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]propanediamide |
| MolecularFormula | C17H14N4O2Cl2 |
| Smiles | O=C(CC(N/N=C\c(cc1)ccc1Cl)=O)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C17H14Cl2N4O2/c18-14-5-1-12(2-6-14)10-20-22-16(24)9-17(25)23-21-11-13-3-7-15(19)8-4-13/h1-8,10-11H,9H2,(H,22,24)(H,23,25) |
| InChIK | QHSPNOITVAUHML-UHFFFAOYSA-N |
| TotalMolweight | 377.23 |
| Molweight | 377.23 |
| MonoisotopicMass | 376.04938 |
| CLogP | 4.2048 |
| CLogS | -5.86 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 285.56 |
| Relative PSA | 0.25221 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 1.5305 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]propanediamide | 2 - N,N'-bis[(Z)-(4-chlorophenyl)methylideneamino]propanediamide