| MolName | 2-[3-(trifluoromethyl)phenyl]-N-[(Z)-(1,2,5-triphenylpyrrol-3-yl)methylideneamino]acetamide |
| MolecularFormula | C32H24N3OF3 |
| Smiles | O=C(Cc1cccc(C(F)(F)F)c1)N/N=C\c(cc1-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C32H24F3N3O/c33-32(34,35)27-16-10-11-23(19-27)20-30(39)37-36-22-26-21-29(24-12-4-1-5-13-24)38(28-17-8-3-9-18-28)31(26)25-14-6-2-7-15-25/h1-19,21-22H,20H2,(H,37,39) |
| InChIK | QHTUAYNVNZMMJE-UHFFFAOYSA-N |
| TotalMolweight | 523.557 |
| Molweight | 523.557 |
| MonoisotopicMass | 523.187146 |
| CLogP | 7.7333 |
| CLogS | -10.333 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 398.69 |
| Relative PSA | 0.10755 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | -1.6513 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.4359 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-(trifluoromethyl)phenyl]-N-[(Z)-(1,2,5-triphenylpyrrol-3-yl)methylideneamino]acetamide | 2 - 2-[3-(trifluoromethyl)phenyl]-N-[(Z)-(1,2,5-triphenylpyrrol-3-yl)methylideneamino]acetamide