| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-nitrophenyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C22H14N10O7 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2ccc(-c3cc([N+]([O-])=O)ccc3)o2)=O)c1-c1cccc([N+]([O-])=O)c1 |
| InChI | InChI=1S/C22H14N10O7/c23-20-21(28-39-27-20)30-19(13-4-2-6-15(10-13)32(36)37)18(25-29-30)22(33)26-24-11-16-7-8-17(38-16)12-3-1-5-14(9-12)31(34)35/h1-11H,(H2,23,27)(H,26,33) |
| InChIK | QHTYYLYQRPYICM-UHFFFAOYSA-N |
| TotalMolweight | 530.416 |
| Molweight | 530.416 |
| MonoisotopicMass | 530.104695 |
| CLogP | 2.5413 |
| CLogS | -5.586 |
| H Acceptors | 17 |
| H Donors | 2 |
| TotalSurfaceArea | 385.75 |
| Relative PSA | 0.49537 |
| PolarSurfaceArea | 241.89 |
| Druglikeness | -1.2778 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 17 |
| Electronegative Atoms | 17 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-nitrophenyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-nitrophenyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]triazole-4-carboxamide