| MolName | N-[(Z)-furan-2-ylmethylideneamino]-2-hydroxy-2-phenylacetamide |
| MolecularFormula | C13H12N2O3 |
| Smiles | OC(C(N/N=C\c1ccco1)=O)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O3/c16-12(10-5-2-1-3-6-10)13(17)15-14-9-11-7-4-8-18-11/h1-9,12,16H,(H,15,17)/t12-/m1/s1 |
| InChIK | QHYJUMPSGNWSSD-GFCCVEGCSA-N |
| TotalMolweight | 244.249 |
| Molweight | 244.249 |
| MonoisotopicMass | 244.084793 |
| CLogP | 1.3183 |
| CLogS | -2.82 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 195.53 |
| Relative PSA | 0.32333 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | 5.0644 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon | racemate |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-2-hydroxy-2-phenylacetamide | 2 - N-[(Z)-furan-2-ylmethylideneamino]-2-hydroxy-2-phenylacetamide