| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[5-(3-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C28H20N3O5Br |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c(cc1)cc2c1OCO2)N/N=C\c1ccc(-c2cccc(Br)c2)o1 |
| InChI | InChI=1S/C28H20BrN3O5/c29-21-8-4-7-20(15-21)24-12-10-22(37-24)16-30-32-28(34)23(31-27(33)19-5-2-1-3-6-19)13-18-9-11-25-26(14-18)36-17-35-25/h1-16H,17H2,(H,31,33)(H,32,34) |
| InChIK | QIOQGPCFRQLCIA-UHFFFAOYSA-N |
| TotalMolweight | 558.387 |
| Molweight | 558.387 |
| MonoisotopicMass | 557.058633 |
| CLogP | 6.5938 |
| CLogS | -8.471 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 389.01 |
| Relative PSA | 0.24323 |
| PolarSurfaceArea | 102.16 |
| Druglikeness | 6.2033 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48649 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[5-(3-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[5-(3-bromophenyl)furan-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide