| MolName | 2-[(Z)-(3,4-dichlorophenyl)methylideneamino]guanidine |
| MolecularFormula | C8H8N4Cl2 |
| Smiles | NC(N)=N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl2N4/c9-6-2-1-5(3-7(6)10)4-13-14-8(11)12/h1-4H,(H4,11,12,14) |
| InChIK | QITKCQWRUKVTKJ-UHFFFAOYSA-N |
| TotalMolweight | 231.086 |
| Molweight | 231.086 |
| MonoisotopicMass | 230.0126 |
| CLogP | 3.0853 |
| CLogS | -4.462 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 168.87 |
| Relative PSA | 0.31717 |
| PolarSurfaceArea | 76.76 |
| Druglikeness | 1.5916 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(3,4-dichlorophenyl)methylideneamino]guanidine | 2 - 2-[(Z)-(3,4-dichlorophenyl)methylideneamino]guanidine