| MolName | 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea |
| MolecularFormula | C24H24N4O4S2 |
| Smiles | O=S(c(cc1)ccc1NC(N/N=C\c1cc(Oc2ccccc2)ccc1)=S)(N1CCOCC1)=O |
| InChI | InChI=1S/C24H24N4O4S2/c29-34(30,28-13-15-31-16-14-28)23-11-9-20(10-12-23)26-24(33)27-25-18-19-5-4-8-22(17-19)32-21-6-2-1-3-7-21/h1-12,17-18H,13-16H2,(H2,26,27,33) |
| InChIK | QITRUCJZUUIMPG-UHFFFAOYSA-N |
| TotalMolweight | 496.611 |
| Molweight | 496.611 |
| MonoisotopicMass | 496.123896 |
| CLogP | 4.0306 |
| CLogS | -5.824 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 373.59 |
| Relative PSA | 0.30665 |
| PolarSurfaceArea | 132.73 |
| Druglikeness | 4.3865 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea | 2 - 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(Z)-(3-phenoxyphenyl)methylideneamino]thiourea