| MolName | 2,6-bis(azepan-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyrimidin-4-amine |
| MolecularFormula | C23H31N7O2 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nc(N3CCCCCC3)nc(N3CCCCCC3)c2)cc1)=O |
| InChI | InChI=1S/C23H31N7O2/c31-30(32)20-11-9-19(10-12-20)18-24-27-21-17-22(28-13-5-1-2-6-14-28)26-23(25-21)29-15-7-3-4-8-16-29/h9-12,17-18H,1-8,13-16H2,(H,25,26,27) |
| InChIK | QIYKSACABRUYDC-UHFFFAOYSA-N |
| TotalMolweight | 437.546 |
| Molweight | 437.546 |
| MonoisotopicMass | 437.253923 |
| CLogP | 5.4376 |
| CLogS | -6.45 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 349.15 |
| Relative PSA | 0.23609 |
| PolarSurfaceArea | 102.47 |
| Druglikeness | -5.04 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,6-bis(azepan-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyrimidin-4-amine | 2 - 2,6-bis(azepan-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]pyrimidin-4-amine