| MolName | (Z)-1-[3,5-dichloro-2-[(4-chlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C16H11N4OCl3 |
| Smiles | Clc1ccc(COc(c(/C=N\n2cnnc2)cc(Cl)c2)c2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3N4O/c17-13-3-1-11(2-4-13)8-24-16-12(5-14(18)6-15(16)19)7-22-23-9-20-21-10-23/h1-7,9-10H,8H2 |
| InChIK | QJCGUJFZAZMARY-UHFFFAOYSA-N |
| TotalMolweight | 381.649 |
| Molweight | 381.649 |
| MonoisotopicMass | 379.999842 |
| CLogP | 4.3944 |
| CLogS | -7.859 |
| H Acceptors | 5 |
| TotalSurfaceArea | 274.28 |
| Relative PSA | 0.18346 |
| PolarSurfaceArea | 52.3 |
| Druglikeness | 3.0785 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3,5-dichloro-2-[(4-chlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[3,5-dichloro-2-[(4-chlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine