| MolName | [4-[(Z)-[[6-[(2Z)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
| MolecularFormula | C34H26N8O14 |
| Smiles | [O-][N+](c1cc(C(Oc2ccc(/C=N\NC(CCCCC(N/N=C\c(cc3)ccc3OC(c3cc([N+]([O-])=O)cc([N+]([O-])=O)c3)=O)=O)=O)cc2)=O)cc([N+]([O-])=O)c1)=O |
| InChI | InChI=1S/C34H26N8O14/c43-31(37-35-19-21-5-9-29(10-6-21)55-33(45)23-13-25(39(47)48)17-26(14-23)40(49)50)3-1-2-4-32(44)38-36-20-22-7-11-30(12-8-22)56-34(46)24-15-27(41(51)52)18-28(16-24)42(53)54/h5-20H,1-4H2,(H,37,43)(H,38,44) |
| InChIK | QJLLUFBEAHXKBB-UHFFFAOYSA-N |
| TotalMolweight | 770.622 |
| Molweight | 770.622 |
| MonoisotopicMass | 770.156852 |
| CLogP | 3.5306 |
| CLogS | -9.978 |
| H Acceptors | 22 |
| H Donors | 2 |
| TotalSurfaceArea | 565.7 |
| Relative PSA | 0.42386 |
| PolarSurfaceArea | 318.8 |
| Druglikeness | -9.4676 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 56 |
| NonCHAtoms | 22 |
| Electronegative Atoms | 22 |
| Rotatable Bond | 19 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 10 |
| Symmetricatoms | 35 |
| AcidicOxygens | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[6-[(2Z)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate | 2 - [4-[(Z)-[[6-[(2Z)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-6-oxohexanoyl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate