| MolName | N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C22H28N8O2 |
| Smiles | [O-][N+](c1c(/C=C/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cccc1)=O |
| InChI | InChI=1S/C22H28N8O2/c31-30(32)19-12-4-3-10-18(19)11-9-13-23-27-20-24-21(28-14-5-1-6-15-28)26-22(25-20)29-16-7-2-8-17-29/h3-4,9-13H,1-2,5-8,14-17H2,(H,24,25,26,27) |
| InChIK | QJQGUFYHMINENT-UHFFFAOYSA-N |
| TotalMolweight | 436.518 |
| Molweight | 436.518 |
| MonoisotopicMass | 436.233522 |
| CLogP | 4.514 |
| CLogS | -6.071 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 346.89 |
| Relative PSA | 0.26925 |
| PolarSurfaceArea | 115.36 |
| Druglikeness | -2.5234 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine