| MolName | 1-N,4-N-bis[(Z)-(2,6-dinitrophenyl)methylideneamino]phthalazine-1,4-diamine |
| MolecularFormula | C22H14N10O8 |
| Smiles | [O-][N+](c1cccc([N+]([O-])=O)c1/C=N\Nc(c1ccccc11)nnc1N/N=C\c(c([N+]([O-])=O)ccc1)c1[N+]([O-])=O)=O |
| InChI | InChI=1S/C22H14N10O8/c33-29(34)17-7-3-8-18(30(35)36)15(17)11-23-25-21-13-5-1-2-6-14(13)22(28-27-21)26-24-12-16-19(31(37)38)9-4-10-20(16)32(39)40/h1-12H,(H,25,27)(H,26,28) |
| InChIK | QJQKWKADYMXPOK-UHFFFAOYSA-N |
| TotalMolweight | 546.415 |
| Molweight | 546.415 |
| MonoisotopicMass | 546.09961 |
| CLogP | 4.4032 |
| CLogS | -7.932 |
| H Acceptors | 18 |
| H Donors | 2 |
| TotalSurfaceArea | 392.02 |
| Relative PSA | 0.48355 |
| PolarSurfaceArea | 257.84 |
| Druglikeness | -3.1321 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.45 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 18 |
| Electronegative Atoms | 18 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 25 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-N,4-N-bis[(Z)-(2,6-dinitrophenyl)methylideneamino]phthalazine-1,4-diamine | 2 - 1-N,4-N-bis[(Z)-(2,6-dinitrophenyl)methylideneamino]phthalazine-1,4-diamine