| MolName | 2-[[4-[[5-sulfanylidene-4-[(Z)-thiophen-2-ylmethylideneamino]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]piperazin-1-yl]methyl]-4-[(Z)-thiophen-2-ylmethylideneamino]-5-(trifluoromethyl)-1,2,4-triazole-3-thione |
| MolecularFormula | C22H20N10F6S4 |
| Smiles | FC(C(N1N=Cc2cccs2)=NN(CN2CCN(CN(C3=S)N=C(C(F)(F)F)N3N=Cc3cccs3)CC2)C1=S)(F)F |
| InChI | InChI=1S/C22H20F6N10S4/c23-21(24,25)17-31-35(19(39)37(17)29-11-15-3-1-9-41-15)13-33-5-7-34(8-6-33)14-36-20(40)38(18(32-36)22(26,27)28)30-12-16-4-2-10-42-16/h1-4,9-12H,5-8,13-14H2 |
| InChIK | QKBSWHAEVLCNEV-UHFFFAOYSA-N |
| TotalMolweight | 666.723 |
| Molweight | 666.723 |
| MonoisotopicMass | 666.065938 |
| CLogP | 4.1426 |
| CLogS | -6.718 |
| H Acceptors | 10 |
| TotalSurfaceArea | 448.56 |
| Relative PSA | 0.36575 |
| PolarSurfaceArea | 189.54 |
| Druglikeness | -3.3005 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | methanediamine; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 20 |
| Electronegative Atoms | 20 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 12 |
| Symmetricatoms | 24 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-[[5-sulfanylidene-4-[(Z)-thiophen-2-ylmethylideneamino]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]piperazin-1-yl]methyl]-4-[(Z)-thiophen-2-ylmethylideneamino]-5-(trifluoromethyl)-1,2,4-triazole-3-thione | 2 - 2-[[4-[[5-sulfanylidene-4-[(Z)-thiophen-2-ylmethylideneamino]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl]piperazin-1-yl]methyl]-4-[(Z)-thiophen-2-ylmethylideneamino]-5-(trifluoromethyl)-1,2,4-triazole-3-thione