| MolName | 3-amino-N-[(Z)-(2-fluorophenyl)methylideneamino]pyrazine-2-carboxamide |
| MolecularFormula | C12H10N5OF |
| Smiles | Nc1nccnc1C(N/N=C\c(cccc1)c1F)=O |
| InChI | InChI=1S/C12H10FN5O/c13-9-4-2-1-3-8(9)7-17-18-12(19)10-11(14)16-6-5-15-10/h1-7H,(H2,14,16)(H,18,19) |
| InChIK | QKHQJJNBXPAYMA-UHFFFAOYSA-N |
| TotalMolweight | 259.243 |
| Molweight | 259.243 |
| MonoisotopicMass | 259.086938 |
| CLogP | 1.0287 |
| CLogS | -3.07 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 199.38 |
| Relative PSA | 0.36724 |
| PolarSurfaceArea | 93.26 |
| Druglikeness | 3.0505 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-amino-N-[(Z)-(2-fluorophenyl)methylideneamino]pyrazine-2-carboxamide | 2 - 3-amino-N-[(Z)-(2-fluorophenyl)methylideneamino]pyrazine-2-carboxamide