| MolName | [4-bromo-2-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C30H24N3O4Br |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\c(cc(cc1)Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C30H24BrN3O4/c31-25-16-17-26(38-30(37)23-14-8-3-9-15-23)24(18-25)19-33-34-27(35)20-32-29(36)28(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-19,28H,20H2,(H,32,36)(H,34,35) |
| InChIK | QKIBGKWIHFZNEX-UHFFFAOYSA-N |
| TotalMolweight | 570.442 |
| Molweight | 570.442 |
| MonoisotopicMass | 569.095018 |
| CLogP | 5.9667 |
| CLogS | -6.906 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 408.36 |
| Relative PSA | 0.2046 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 4.2479 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 10 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate