| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2,6-bis(azepan-1-yl)pyrimidin-4-amine |
| MolecularFormula | C31H36N6 |
| Smiles | C(CCC1)CCN1c1cc(N/N=C\c2c(cccc3)c3cc3ccccc23)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C31H36N6/c1-2-10-18-36(17-9-1)30-22-29(33-31(34-30)37-19-11-3-4-12-20-37)35-32-23-28-26-15-7-5-13-24(26)21-25-14-6-8-16-27(25)28/h5-8,13-16,21-23H,1-4,9-12,17-20H2,(H,33,34,35) |
| InChIK | QKMWEZPWKXUMBF-UHFFFAOYSA-N |
| TotalMolweight | 492.669 |
| Molweight | 492.669 |
| MonoisotopicMass | 492.300144 |
| CLogP | 9.0888 |
| CLogS | -9.202 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 394.68 |
| Relative PSA | 0.13178 |
| PolarSurfaceArea | 56.65 |
| Druglikeness | 0.31944 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.40541 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 12 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2,6-bis(azepan-1-yl)pyrimidin-4-amine | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2,6-bis(azepan-1-yl)pyrimidin-4-amine